C23H26F2N8O2 — CID 167438821
2-[6-[[3-[4-(difluoromethyl)phenyl]-5-methyltriazol-4-yl]methoxy]pyridazin-3-yl]-8-methyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-4-one (PubChem CID 167438821) has the molecular formula C23H26F2N8O2 and a molecular weight of 484.51 g/mol. Its IUPAC name is 2-[6-[[3-[4-(difluoromethyl)phenyl]-5-methyltriazol-4-yl]methoxy]pyridazin-3-yl]-8-methyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-4-one.
| Compound Name | 2-[6-[[3-[4-(difluoromethyl)phenyl]-5-methyltriazol-4-yl]methoxy]pyridazin-3-yl]-8-methyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-4-one |
|---|---|
| PubChem CID | 167438821 |
| Molecular Formula | C23H26F2N8O2 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | 2-[6-[[3-[4-(difluoromethyl)phenyl]-5-methyltriazol-4-yl]methoxy]pyridazin-3-yl]-8-methyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-4-one |
| SMILES | Cc1nnn(-c2ccc(C(F)F)cc2)c1COc1ccc(N2CC(=O)N3CCN(C)CC3C2)nn1 |
| InChI | InChI=1S/C23H26F2N8O2/c1-15-19(33(29-26-15)17-5-3-16(4-6-17)23(24)25)14-35-21-8-7-20(27-28-21)31-12-18-11-30(2)9-10-32(18)22(34)13-31/h3-8,18,23H,9-14H2,1-2H3 |
| InChIKey | GMMDGDMSNZZFLR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 92.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |