C22H25F2N7O2 — CID 167438828
(9aS)-8-[6-[[3-[4-(difluoromethyl)phenyl]-5-methyltriazol-4-yl]methoxy]pyridazin-3-yl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine (PubChem CID 167438828) has the molecular formula C22H25F2N7O2 and a molecular weight of 457.49 g/mol. Its IUPAC name is (9aS)-8-[6-[[3-[4-(difluoromethyl)phenyl]-5-methyltriazol-4-yl]methoxy]pyridazin-3-yl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine.
| Compound Name | (9aS)-8-[6-[[3-[4-(difluoromethyl)phenyl]-5-methyltriazol-4-yl]methoxy]pyridazin-3-yl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 167438828 |
| Molecular Formula | C22H25F2N7O2 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | (9aS)-8-[6-[[3-[4-(difluoromethyl)phenyl]-5-methyltriazol-4-yl]methoxy]pyridazin-3-yl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine |
| SMILES | Cc1nnn(-c2ccc(C(F)F)cc2)c1COc1ccc(N2CCN3CCOC[C@@H]3C2)nn1 |
| InChI | InChI=1S/C22H25F2N7O2/c1-15-19(31(28-25-15)17-4-2-16(3-5-17)22(23)24)14-33-21-7-6-20(26-27-21)30-9-8-29-10-11-32-13-18(29)12-30/h2-7,18,22H,8-14H2,1H3/t18-/m0/s1 |
| InChIKey | PKLXEEABZGTOJQ-SFHVURJKSA-N |
| XLogP | 2.40 |
| TPSA | 81.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |