About 2-bromo-N-[(4-methoxyphenyl)methyl]-2-methyl-N-[(1E)-4-methylpenta-1,3-dienyl]propanamide
2-bromo-N-[(4-methoxyphenyl)methyl]-2-methyl-N-[(1E)-4-methylpenta-1,3-dienyl]propanamide (PubChem CID 16743899) has the molecular formula C18H24BrNO2
and a molecular weight of 366.30 g/mol. Its IUPAC name is 2-bromo-N-[(4-methoxyphenyl)methyl]-2-methyl-N-[(1E)-4-methylpenta-1,3-dienyl]propanamide.
Molecular Properties
| Compound Name | 2-bromo-N-[(4-methoxyphenyl)methyl]-2-methyl-N-[(1E)-4-methylpenta-1,3-dienyl]propanamide |
| PubChem CID | 16743899 |
| Molecular Formula | C18H24BrNO2 |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 2-bromo-N-[(4-methoxyphenyl)methyl]-2-methyl-N-[(1E)-4-methylpenta-1,3-dienyl]propanamide |
| SMILES | COc1ccc(CN(/C=C/C=C(C)C)C(=O)C(C)(C)Br)cc1 |
| InChI | InChI=1S/C18H24BrNO2/c1-14(2)7-6-12-20(17(21)18(3,4)19)13-15-8-10-16(22-5)11-9-15/h6-12H,13H2,1-5H3/b12-6+ |
| InChIKey | ORGKEROLIYQAAX-WUXMJOGZSA-N |
| XLogP | 4.68 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-N-[(4-methoxyphenyl)methyl]-2-methyl-N-[(1E)-4-methylpenta-1,3-dienyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N-[(4-methoxyphenyl)methyl]-2-methyl-N-[(1E)-4-methylpenta-1,3-dienyl]propanamide?
The IUPAC name of 2-bromo-N-[(4-methoxyphenyl)methyl]-2-methyl-N-[(1E)-4-methylpenta-1,3-dienyl]propanamide (CID 16743899) is 2-bromo-N-[(4-methoxyphenyl)methyl]-2-methyl-N-[(1E)-4-methylpenta-1,3-dienyl]propanamide.
What is the SMILES notation for 2-bromo-N-[(4-methoxyphenyl)methyl]-2-methyl-N-[(1E)-4-methylpenta-1,3-dienyl]propanamide?
The canonical SMILES for 2-bromo-N-[(4-methoxyphenyl)methyl]-2-methyl-N-[(1E)-4-methylpenta-1,3-dienyl]propanamide is COc1ccc(CN(/C=C/C=C(C)C)C(=O)C(C)(C)Br)cc1.
What is the InChIKey of 2-bromo-N-[(4-methoxyphenyl)methyl]-2-methyl-N-[(1E)-4-methylpenta-1,3-dienyl]propanamide?
The InChIKey is ORGKEROLIYQAAX-WUXMJOGZSA-N. The full InChI is InChI=1S/C18H24BrNO2/c1-14(2)7-6-12-20(17(21)18(3,4)19)13-15-8-10-16(22-5)11-9-15/h6-12H,13H2,1-5H3/b12-6+.
What are the key properties of 2-bromo-N-[(4-methoxyphenyl)methyl]-2-methyl-N-[(1E)-4-methylpenta-1,3-dienyl]propanamide?
2-bromo-N-[(4-methoxyphenyl)methyl]-2-methyl-N-[(1E)-4-methylpenta-1,3-dienyl]propanamide has a molecular weight of 366.30 g/mol, XLogP of 4.68, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N-[(4-methoxyphenyl)methyl]-2-methyl-N-[(1E)-4-methylpenta-1,3-dienyl]propanamide is sourced from PubChem (CID 16743899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).