C28H23ClF5N3OS — CID 16743929
N-[(1R)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine (PubChem CID 16743929) has the molecular formula C28H23ClF5N3OS and a molecular weight of 580.02 g/mol. Its IUPAC name is N-[(1R)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine.
| Compound Name | N-[(1R)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 16743929 |
| Molecular Formula | C28H23ClF5N3OS |
| Molecular Weight | 580.02 g/mol |
| Exact Mass | 579.12 |
| IUPAC Name | N-[(1R)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine |
| SMILES | Fc1cc(OC(F)(F)C(F)F)cc([C@@](Cc2ccccc2)(Nc2nc3c(s2)CCCC3)c2ccc(Cl)cn2)c1 |
| InChI | InChI=1S/C28H23ClF5N3OS/c29-19-10-11-24(35-16-19)27(15-17-6-2-1-3-7-17,37-26-36-22-8-4-5-9-23(22)39-26)18-12-20(30)14-21(13-18)38-28(33,34)25(31)32/h1-3,6-7,10-14,16,25H,4-5,8-9,15H2,(H,36,37)/t27-/m1/s1 |
| InChIKey | DSQLWHFBRNOPIP-HHHXNRCGSA-N |
| XLogP | 8.04 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.02 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|