C50H55NO9 — CID 167440055
benzyl (2S,4S)-2-tert-butyl-5-oxo-4-[[(2R,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 167440055) has the molecular formula C50H55NO9 and a molecular weight of 813.99 g/mol. Its IUPAC name is benzyl (2S,4S)-2-tert-butyl-5-oxo-4-[[(2R,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | benzyl (2S,4S)-2-tert-butyl-5-oxo-4-[[(2R,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 167440055 |
| Molecular Formula | C50H55NO9 |
| Molecular Weight | 813.99 g/mol |
| Exact Mass | 813.39 |
| IUPAC Name | benzyl (2S,4S)-2-tert-butyl-5-oxo-4-[[(2R,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)[C@@H]1OC(=O)[C@H](C[C@H]2O[C@H](COCc3ccccc3)[C@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C50H55NO9/c1-50(2,3)48-51(49(53)58-34-40-27-17-8-18-28-40)41(47(52)60-48)29-42-44(55-31-37-21-11-5-12-22-37)46(57-33-39-25-15-7-16-26-39)45(56-32-38-23-13-6-14-24-38)43(59-42)35-54-30-36-19-9-4-10-20-36/h4-28,41-46,48H,29-35H2,1-3H3/t41-,42+,43+,44-,45-,46+,48-/m0/s1 |
| InChIKey | DWGPFJVSYYDDCL-QNOWPQSNSA-N |
| XLogP | 9.05 |
| TPSA | 101.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.99 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |