C43H49NO8 — CID 167440064
benzyl (2S,4S)-2-tert-butyl-4-[[(2S,3S,4R,5S,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl]-5-oxo-1,3-oxazolidine-3-carboxylate (PubChem CID 167440064) has the molecular formula C43H49NO8 and a molecular weight of 707.86 g/mol. Its IUPAC name is benzyl (2S,4S)-2-tert-butyl-4-[[(2S,3S,4R,5S,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl]-5-oxo-1,3-oxazolidine-3-carboxylate.
| Compound Name | benzyl (2S,4S)-2-tert-butyl-4-[[(2S,3S,4R,5S,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl]-5-oxo-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 167440064 |
| Molecular Formula | C43H49NO8 |
| Molecular Weight | 707.86 g/mol |
| Exact Mass | 707.35 |
| IUPAC Name | benzyl (2S,4S)-2-tert-butyl-4-[[(2S,3S,4R,5S,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl]-5-oxo-1,3-oxazolidine-3-carboxylate |
| SMILES | C[C@@H]1O[C@@H](C[C@H]2C(=O)O[C@@H](C(C)(C)C)N2C(=O)OCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C43H49NO8/c1-30-37(47-26-31-17-9-5-10-18-31)39(49-28-33-21-13-7-14-22-33)38(48-27-32-19-11-6-12-20-32)36(51-30)25-35-40(45)52-41(43(2,3)4)44(35)42(46)50-29-34-23-15-8-16-24-34/h5-24,30,35-39,41H,25-29H2,1-4H3/t30-,35-,36-,37-,38-,39+,41-/m0/s1 |
| InChIKey | AYUXJQGYGKKDIX-LYPXCUMSSA-N |
| XLogP | 7.86 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.86 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |