C21H29FO4Si — CID 167440330
[2-[(3,5-dimethylphenoxy)methyl]-5-fluorophenyl]-triethoxysilane (PubChem CID 167440330) has the molecular formula C21H29FO4Si and a molecular weight of 392.54 g/mol. Its IUPAC name is [2-[(3,5-dimethylphenoxy)methyl]-5-fluorophenyl]-triethoxysilane.
| Compound Name | [2-[(3,5-dimethylphenoxy)methyl]-5-fluorophenyl]-triethoxysilane |
|---|---|
| PubChem CID | 167440330 |
| Molecular Formula | C21H29FO4Si |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | [2-[(3,5-dimethylphenoxy)methyl]-5-fluorophenyl]-triethoxysilane |
| SMILES | CCO[Si](OCC)(OCC)c1cc(F)ccc1COc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C21H29FO4Si/c1-6-24-27(25-7-2,26-8-3)21-14-19(22)10-9-18(21)15-23-20-12-16(4)11-17(5)13-20/h9-14H,6-8,15H2,1-5H3 |
| InChIKey | IDBWZFIKPHDKIS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|