C21H27F3N2O — CID 167440973
(4aR,10bS)-N-butyl-10b-methyl-4a-(2,2,2-trifluoroethyl)-1,2,3,4-tetrahydrophenanthridine-6-carboxamide (PubChem CID 167440973) has the molecular formula C21H27F3N2O and a molecular weight of 380.45 g/mol. Its IUPAC name is (4aR,10bS)-N-butyl-10b-methyl-4a-(2,2,2-trifluoroethyl)-1,2,3,4-tetrahydrophenanthridine-6-carboxamide.
| Compound Name | (4aR,10bS)-N-butyl-10b-methyl-4a-(2,2,2-trifluoroethyl)-1,2,3,4-tetrahydrophenanthridine-6-carboxamide |
|---|---|
| PubChem CID | 167440973 |
| Molecular Formula | C21H27F3N2O |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | (4aR,10bS)-N-butyl-10b-methyl-4a-(2,2,2-trifluoroethyl)-1,2,3,4-tetrahydrophenanthridine-6-carboxamide |
| SMILES | CCCCNC(=O)C1=N[C@@]2(CC(F)(F)F)CCCC[C@@]2(C)c2ccccc21 |
| InChI | InChI=1S/C21H27F3N2O/c1-3-4-13-25-18(27)17-15-9-5-6-10-16(15)19(2)11-7-8-12-20(19,26-17)14-21(22,23)24/h5-6,9-10H,3-4,7-8,11-14H2,1-2H3,(H,25,27)/t19-,20+/m0/s1 |
| InChIKey | LPMDFPPVQKDQSD-VQTJNVASSA-N |
| XLogP | 4.93 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|