About [4-(acetyloxymethyl)-2,5-dimethylphenyl]methyl acetate
[4-(acetyloxymethyl)-2,5-dimethylphenyl]methyl acetate (PubChem CID 16744147) has the molecular formula C14H18O4
and a molecular weight of 250.29 g/mol. Its IUPAC name is [4-(acetyloxymethyl)-2,5-dimethylphenyl]methyl acetate.
Molecular Properties
| Compound Name | [4-(acetyloxymethyl)-2,5-dimethylphenyl]methyl acetate |
| PubChem CID | 16744147 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | [4-(acetyloxymethyl)-2,5-dimethylphenyl]methyl acetate |
| SMILES | CC(=O)OCc1cc(C)c(COC(C)=O)cc1C |
| InChI | InChI=1S/C14H18O4/c1-9-5-14(8-18-12(4)16)10(2)6-13(9)7-17-11(3)15/h5-6H,7-8H2,1-4H3 |
| InChIKey | JYZSGIVRVOEGEP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-(acetyloxymethyl)-2,5-dimethylphenyl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(acetyloxymethyl)-2,5-dimethylphenyl]methyl acetate?
The IUPAC name of [4-(acetyloxymethyl)-2,5-dimethylphenyl]methyl acetate (CID 16744147) is [4-(acetyloxymethyl)-2,5-dimethylphenyl]methyl acetate.
What is the SMILES notation for [4-(acetyloxymethyl)-2,5-dimethylphenyl]methyl acetate?
The canonical SMILES for [4-(acetyloxymethyl)-2,5-dimethylphenyl]methyl acetate is CC(=O)OCc1cc(C)c(COC(C)=O)cc1C.
What is the InChIKey of [4-(acetyloxymethyl)-2,5-dimethylphenyl]methyl acetate?
The InChIKey is JYZSGIVRVOEGEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O4/c1-9-5-14(8-18-12(4)16)10(2)6-13(9)7-17-11(3)15/h5-6H,7-8H2,1-4H3.
What are the key properties of [4-(acetyloxymethyl)-2,5-dimethylphenyl]methyl acetate?
[4-(acetyloxymethyl)-2,5-dimethylphenyl]methyl acetate has a molecular weight of 250.29 g/mol, XLogP of 2.43, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(acetyloxymethyl)-2,5-dimethylphenyl]methyl acetate is sourced from PubChem (CID 16744147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).