About CID 16744161
CID 16744161 (PubChem CID 16744161) has the molecular formula C38H28BO5P2
and a molecular weight of 637.40 g/mol.
Molecular Properties
| Compound Name | CID 16744161 |
| PubChem CID | 16744161 |
| Molecular Formula | C38H28BO5P2 |
| Molecular Weight | 637.40 g/mol |
| Exact Mass | 637.15 |
| IUPAC Name | — |
| SMILES | O=P(c1ccccc1)(c1ccccc1)c1ccc2c(c1-c1c(P(c3ccccc3)c3ccccc3)ccc3c1OCO3)OCO2.[B] |
| InChI | InChI=1S/C38H28O5P2.B/c39-45(29-17-9-3-10-18-29,30-19-11-4-12-20-30)34-24-22-32-38(43-26-41-32)36(34)35-33(23-21-31-37(35)42-25-40-31)44(27-13-5-1-6-14-27)28-15-7-2-8-16-28;/h1-24H,25-26H2; |
| InChIKey | NFOXOZAAWXFETL-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 637.40 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 16744161 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 16744161?
The IUPAC name of CID 16744161 (CID 16744161) is not available.
What is the SMILES notation for CID 16744161?
The canonical SMILES for CID 16744161 is O=P(c1ccccc1)(c1ccccc1)c1ccc2c(c1-c1c(P(c3ccccc3)c3ccccc3)ccc3c1OCO3)OCO2.[B].
What is the InChIKey of CID 16744161?
The InChIKey is NFOXOZAAWXFETL-UHFFFAOYSA-N. The full InChI is InChI=1S/C38H28O5P2.B/c39-45(29-17-9-3-10-18-29,30-19-11-4-12-20-30)34-24-22-32-38(43-26-41-32)36(34)35-33(23-21-31-37(35)42-25-40-31)44(27-13-5-1-6-14-27)28-15-7-2-8-16-28;/h1-24H,25-26H2;.
What are the key properties of CID 16744161?
CID 16744161 has a molecular weight of 637.40 g/mol, XLogP of 5.83, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 16744161 is sourced from PubChem (CID 16744161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).