C24H21F2N5O2 — CID 167442148
(E)-N-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]-3-(6-methylquinolin-2-yl)prop-2-enamide (PubChem CID 167442148) has the molecular formula C24H21F2N5O2 and a molecular weight of 449.46 g/mol. Its IUPAC name is (E)-N-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]-3-(6-methylquinolin-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]-3-(6-methylquinolin-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 167442148 |
| Molecular Formula | C24H21F2N5O2 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | (E)-N-[2-(2,4-difluorophenyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]-3-(6-methylquinolin-2-yl)prop-2-enamide |
| SMILES | Cc1ccc2nc(/C=C/C(=O)NCC(O)(Cn3cncn3)c3ccc(F)cc3F)ccc2c1 |
| InChI | InChI=1S/C24H21F2N5O2/c1-16-2-8-22-17(10-16)3-5-19(30-22)6-9-23(32)28-12-24(33,13-31-15-27-14-29-31)20-7-4-18(25)11-21(20)26/h2-11,14-15,33H,12-13H2,1H3,(H,28,32)/b9-6+ |
| InChIKey | QSVLFFMMFKKEFX-RMKNXTFCSA-N |
| XLogP | 3.13 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|