C25H38O3 — CID 167442737
4-[(2S)-1-[(1R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-4-methylpentan-2-yl]-5-hydroxy-2,2,6,6-tetramethylcyclohex-4-ene-1,3-dione (PubChem CID 167442737) has the molecular formula C25H38O3 and a molecular weight of 386.58 g/mol. Its IUPAC name is 4-[(2S)-1-[(1R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-4-methylpentan-2-yl]-5-hydroxy-2,2,6,6-tetramethylcyclohex-4-ene-1,3-dione.
| Compound Name | 4-[(2S)-1-[(1R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-4-methylpentan-2-yl]-5-hydroxy-2,2,6,6-tetramethylcyclohex-4-ene-1,3-dione |
|---|---|
| PubChem CID | 167442737 |
| Molecular Formula | C25H38O3 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | 4-[(2S)-1-[(1R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-4-methylpentan-2-yl]-5-hydroxy-2,2,6,6-tetramethylcyclohex-4-ene-1,3-dione |
| SMILES | CC(C)C[C@@H](CC1=CCC2C[C@@H]1C2(C)C)C1=C(O)C(C)(C)C(=O)C(C)(C)C1=O |
| InChI | InChI=1S/C25H38O3/c1-14(2)11-16(12-15-9-10-17-13-18(15)23(17,3)4)19-20(26)24(5,6)22(28)25(7,8)21(19)27/h9,14,16-18,26H,10-13H2,1-8H3/t16-,17?,18-/m0/s1 |
| InChIKey | RATBIMAQZWTQOG-RGBJRUIASA-N |
| XLogP | 6.05 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|