About (Z)-5-N-ethyl-2,10-dimethyl-7-N-methylideneundec-6-ene-5,7-diimine
(Z)-5-N-ethyl-2,10-dimethyl-7-N-methylideneundec-6-ene-5,7-diimine (PubChem CID 167443347) has the molecular formula C16H30N2
and a molecular weight of 250.43 g/mol. Its IUPAC name is (Z)-5-N-ethyl-2,10-dimethyl-7-N-methylideneundec-6-ene-5,7-diimine.
Molecular Properties
| Compound Name | (Z)-5-N-ethyl-2,10-dimethyl-7-N-methylideneundec-6-ene-5,7-diimine |
| PubChem CID | 167443347 |
| Molecular Formula | C16H30N2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.24 |
| IUPAC Name | (Z)-5-N-ethyl-2,10-dimethyl-7-N-methylideneundec-6-ene-5,7-diimine |
| SMILES | C=N/C(=C\C(CCC(C)C)=N\CC)CCC(C)C |
| InChI | InChI=1S/C16H30N2/c1-7-18-16(11-9-14(4)5)12-15(17-6)10-8-13(2)3/h12-14H,6-11H2,1-5H3/b15-12-,18-16+ |
| InChIKey | FYVGUELZVIEAON-RZUHJYTCSA-N |
| XLogP | 4.90 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-5-N-ethyl-2,10-dimethyl-7-N-methylideneundec-6-ene-5,7-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-5-N-ethyl-2,10-dimethyl-7-N-methylideneundec-6-ene-5,7-diimine?
The IUPAC name of (Z)-5-N-ethyl-2,10-dimethyl-7-N-methylideneundec-6-ene-5,7-diimine (CID 167443347) is (Z)-5-N-ethyl-2,10-dimethyl-7-N-methylideneundec-6-ene-5,7-diimine.
What is the SMILES notation for (Z)-5-N-ethyl-2,10-dimethyl-7-N-methylideneundec-6-ene-5,7-diimine?
The canonical SMILES for (Z)-5-N-ethyl-2,10-dimethyl-7-N-methylideneundec-6-ene-5,7-diimine is C=N/C(=C\C(CCC(C)C)=N\CC)CCC(C)C.
What is the InChIKey of (Z)-5-N-ethyl-2,10-dimethyl-7-N-methylideneundec-6-ene-5,7-diimine?
The InChIKey is FYVGUELZVIEAON-RZUHJYTCSA-N. The full InChI is InChI=1S/C16H30N2/c1-7-18-16(11-9-14(4)5)12-15(17-6)10-8-13(2)3/h12-14H,6-11H2,1-5H3/b15-12-,18-16+.
What are the key properties of (Z)-5-N-ethyl-2,10-dimethyl-7-N-methylideneundec-6-ene-5,7-diimine?
(Z)-5-N-ethyl-2,10-dimethyl-7-N-methylideneundec-6-ene-5,7-diimine has a molecular weight of 250.43 g/mol, XLogP of 4.90, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-5-N-ethyl-2,10-dimethyl-7-N-methylideneundec-6-ene-5,7-diimine is sourced from PubChem (CID 167443347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).