C20H27FN8 — CID 167443480
N'-diazenyl-2-fluoro-4-(2-methylpropyl)-6-[4-(pyridazin-3-ylmethyl)piperazin-1-yl]benzenecarboximidamide (PubChem CID 167443480) has the molecular formula C20H27FN8 and a molecular weight of 398.49 g/mol. Its IUPAC name is N'-diazenyl-2-fluoro-4-(2-methylpropyl)-6-[4-(pyridazin-3-ylmethyl)piperazin-1-yl]benzenecarboximidamide.
| Compound Name | N'-diazenyl-2-fluoro-4-(2-methylpropyl)-6-[4-(pyridazin-3-ylmethyl)piperazin-1-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 167443480 |
| Molecular Formula | C20H27FN8 |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | N'-diazenyl-2-fluoro-4-(2-methylpropyl)-6-[4-(pyridazin-3-ylmethyl)piperazin-1-yl]benzenecarboximidamide |
| SMILES | [H]/N=N/N=C(N)c1c(F)cc(CC(C)C)cc1N1CCN(Cc2cccnn2)CC1 |
| InChI | InChI=1S/C20H27FN8/c1-14(2)10-15-11-17(21)19(20(22)26-27-23)18(12-15)29-8-6-28(7-9-29)13-16-4-3-5-24-25-16/h3-5,11-12,14H,6-10,13H2,1-2H3,(H3,22,23,26) |
| InChIKey | PPYXYTSNWDACCB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 106.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|