C22H35FN7S+ — CID 167443677
(Z)-[amino-[2-fluoro-6-[(3S)-3-methyl-4-[1-(5-methyl-1,3-thiazol-2-yl)ethyl]piperazin-1-yl]-4-(2-methylpropyl)phenyl]methylidene]-hydrazinylazanium (PubChem CID 167443677) has the molecular formula C22H35FN7S+ and a molecular weight of 448.64 g/mol. Its IUPAC name is (Z)-[amino-[2-fluoro-6-[(3S)-3-methyl-4-[1-(5-methyl-1,3-thiazol-2-yl)ethyl]piperazin-1-yl]-4-(2-methylpropyl)phenyl]methylidene]-hydrazinylazanium.
| Compound Name | (Z)-[amino-[2-fluoro-6-[(3S)-3-methyl-4-[1-(5-methyl-1,3-thiazol-2-yl)ethyl]piperazin-1-yl]-4-(2-methylpropyl)phenyl]methylidene]-hydrazinylazanium |
|---|---|
| PubChem CID | 167443677 |
| Molecular Formula | C22H35FN7S+ |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | (Z)-[amino-[2-fluoro-6-[(3S)-3-methyl-4-[1-(5-methyl-1,3-thiazol-2-yl)ethyl]piperazin-1-yl]-4-(2-methylpropyl)phenyl]methylidene]-hydrazinylazanium |
| SMILES | Cc1cnc(C(C)N2CCN(c3cc(CC(C)C)cc(F)c3/C(N)=[NH+]/NN)C[C@@H]2C)s1 |
| InChI | InChI=1S/C22H34FN7S/c1-13(2)8-17-9-18(23)20(21(24)27-28-25)19(10-17)29-6-7-30(14(3)12-29)16(5)22-26-11-15(4)31-22/h9-11,13-14,16,28H,6-8,12,25H2,1-5H3,(H2,24,27)/p+1/t14-,16?/m0/s1 |
| InChIKey | YLPOJSMCRPBTEZ-LBAUFKAWSA-O |
| XLogP | 1.23 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|