C23H19ClF2N2O3S2 — CID 167444931
3-[4-chloro-2-(3,3-difluorocyclobutyl)oxy-5-(1,2-thiazol-5-yl)anilino]sulfanyl-4-cyclopropylbenzoic acid (PubChem CID 167444931) has the molecular formula C23H19ClF2N2O3S2 and a molecular weight of 509.00 g/mol. Its IUPAC name is 3-[4-chloro-2-(3,3-difluorocyclobutyl)oxy-5-(1,2-thiazol-5-yl)anilino]sulfanyl-4-cyclopropylbenzoic acid.
| Compound Name | 3-[4-chloro-2-(3,3-difluorocyclobutyl)oxy-5-(1,2-thiazol-5-yl)anilino]sulfanyl-4-cyclopropylbenzoic acid |
|---|---|
| PubChem CID | 167444931 |
| Molecular Formula | C23H19ClF2N2O3S2 |
| Molecular Weight | 509.00 g/mol |
| Exact Mass | 508.05 |
| IUPAC Name | 3-[4-chloro-2-(3,3-difluorocyclobutyl)oxy-5-(1,2-thiazol-5-yl)anilino]sulfanyl-4-cyclopropylbenzoic acid |
| SMILES | O=C(O)c1ccc(C2CC2)c(SNc2cc(-c3ccns3)c(Cl)cc2OC2CC(F)(F)C2)c1 |
| InChI | InChI=1S/C23H19ClF2N2O3S2/c24-17-9-19(31-14-10-23(25,26)11-14)18(8-16(17)20-5-6-27-32-20)28-33-21-7-13(22(29)30)3-4-15(21)12-1-2-12/h3-9,12,14,28H,1-2,10-11H2,(H,29,30) |
| InChIKey | JDGFDODLEXIIPP-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.00 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|