About cis-(1S,2S)-2-methylcyclopentane-1-carbonitrile;ethane
cis-(1S,2S)-2-methylcyclopentane-1-carbonitrile;ethane (PubChem CID 167444944) has the molecular formula C9H17N
and a molecular weight of 139.24 g/mol. Its IUPAC name is cis-(1S,2S)-2-methylcyclopentane-1-carbonitrile;ethane.
Molecular Properties
| Compound Name | cis-(1S,2S)-2-methylcyclopentane-1-carbonitrile;ethane |
| PubChem CID | 167444944 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | cis-(1S,2S)-2-methylcyclopentane-1-carbonitrile;ethane |
| SMILES | CC.C[C@H]1CCC[C@@H]1C#N |
| InChI | InChI=1S/C7H11N.C2H6/c1-6-3-2-4-7(6)5-8;1-2/h6-7H,2-4H2,1H3;1-2H3/t6-,7+;/m0./s1 |
| InChIKey | GCVISWRHUCLREH-UOERWJHTSA-N |
| XLogP | 2.97 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cis-(1S,2S)-2-methylcyclopentane-1-carbonitrile;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,2S)-2-methylcyclopentane-1-carbonitrile;ethane?
The IUPAC name of cis-(1S,2S)-2-methylcyclopentane-1-carbonitrile;ethane (CID 167444944) is cis-(1S,2S)-2-methylcyclopentane-1-carbonitrile;ethane.
What is the SMILES notation for cis-(1S,2S)-2-methylcyclopentane-1-carbonitrile;ethane?
The canonical SMILES for cis-(1S,2S)-2-methylcyclopentane-1-carbonitrile;ethane is CC.C[C@H]1CCC[C@@H]1C#N.
What is the InChIKey of cis-(1S,2S)-2-methylcyclopentane-1-carbonitrile;ethane?
The InChIKey is GCVISWRHUCLREH-UOERWJHTSA-N. The full InChI is InChI=1S/C7H11N.C2H6/c1-6-3-2-4-7(6)5-8;1-2/h6-7H,2-4H2,1H3;1-2H3/t6-,7+;/m0./s1.
What are the key properties of cis-(1S,2S)-2-methylcyclopentane-1-carbonitrile;ethane?
cis-(1S,2S)-2-methylcyclopentane-1-carbonitrile;ethane has a molecular weight of 139.24 g/mol, XLogP of 2.97, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,2S)-2-methylcyclopentane-1-carbonitrile;ethane is sourced from PubChem (CID 167444944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).