C19H22FN3O2 — CID 167445165
N-ethyl-N'-[5-fluoro-2-methyl-4-(3-pyridin-2-yloxyoxetan-3-yl)phenyl]-N-methylmethanimidamide (PubChem CID 167445165) has the molecular formula C19H22FN3O2 and a molecular weight of 343.40 g/mol. Its IUPAC name is N-ethyl-N'-[5-fluoro-2-methyl-4-(3-pyridin-2-yloxyoxetan-3-yl)phenyl]-N-methylmethanimidamide.
| Compound Name | N-ethyl-N'-[5-fluoro-2-methyl-4-(3-pyridin-2-yloxyoxetan-3-yl)phenyl]-N-methylmethanimidamide |
|---|---|
| PubChem CID | 167445165 |
| Molecular Formula | C19H22FN3O2 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | N-ethyl-N'-[5-fluoro-2-methyl-4-(3-pyridin-2-yloxyoxetan-3-yl)phenyl]-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(F)c(C2(Oc3ccccn3)COC2)cc1C |
| InChI | InChI=1S/C19H22FN3O2/c1-4-23(3)13-22-17-10-16(20)15(9-14(17)2)19(11-24-12-19)25-18-7-5-6-8-21-18/h5-10,13H,4,11-12H2,1-3H3/b22-13+ |
| InChIKey | PXIVAPBJGIBCKT-LPYMAVHISA-N |
| XLogP | 3.45 |
| TPSA | 46.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|