C20H27N3O4S — CID 167445511
tert-butyl N-[3-(2,3-dihydro-1,4-benzodioxin-5-ylcarbamothioylamino)hex-4-ynyl]carbamate (PubChem CID 167445511) has the molecular formula C20H27N3O4S and a molecular weight of 405.52 g/mol. Its IUPAC name is tert-butyl N-[3-(2,3-dihydro-1,4-benzodioxin-5-ylcarbamothioylamino)hex-4-ynyl]carbamate.
| Compound Name | tert-butyl N-[3-(2,3-dihydro-1,4-benzodioxin-5-ylcarbamothioylamino)hex-4-ynyl]carbamate |
|---|---|
| PubChem CID | 167445511 |
| Molecular Formula | C20H27N3O4S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | tert-butyl N-[3-(2,3-dihydro-1,4-benzodioxin-5-ylcarbamothioylamino)hex-4-ynyl]carbamate |
| SMILES | CC#CC(CCNC(=O)OC(C)(C)C)NC(=S)Nc1cccc2c1OCCO2 |
| InChI | InChI=1S/C20H27N3O4S/c1-5-7-14(10-11-21-19(24)27-20(2,3)4)22-18(28)23-15-8-6-9-16-17(15)26-13-12-25-16/h6,8-9,14H,10-13H2,1-4H3,(H,21,24)(H2,22,23,28) |
| InChIKey | YIDOHNBYSPPJOX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|