C26H21ClF5N3OS — CID 16744595
N-[(1R)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-4,5-dimethyl-1,3-thiazol-2-amine (PubChem CID 16744595) has the molecular formula C26H21ClF5N3OS and a molecular weight of 553.98 g/mol. Its IUPAC name is N-[(1R)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-4,5-dimethyl-1,3-thiazol-2-amine.
| Compound Name | N-[(1R)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-4,5-dimethyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 16744595 |
| Molecular Formula | C26H21ClF5N3OS |
| Molecular Weight | 553.98 g/mol |
| Exact Mass | 553.10 |
| IUPAC Name | N-[(1R)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-4,5-dimethyl-1,3-thiazol-2-amine |
| SMILES | Cc1nc(N[C@](Cc2ccccc2)(c2cc(F)cc(OC(F)(F)C(F)F)c2)c2ccc(Cl)cn2)sc1C |
| InChI | InChI=1S/C26H21ClF5N3OS/c1-15-16(2)37-24(34-15)35-25(13-17-6-4-3-5-7-17,22-9-8-19(27)14-33-22)18-10-20(28)12-21(11-18)36-26(31,32)23(29)30/h3-12,14,23H,13H2,1-2H3,(H,34,35)/t25-/m1/s1 |
| InChIKey | OZMNGIYROHCDQU-RUZDIDTESA-N |
| XLogP | 7.78 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.98 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|