C28H25F3N8O — CID 167446704
N-[6-[3-(4-amino-3-methanimidoylanilino)indazol-1-yl]-2-pyridinyl]-2-(2,2,2-trifluoroethyl)-3,4-dihydro-2H-azepine-6-carboxamide (PubChem CID 167446704) has the molecular formula C28H25F3N8O and a molecular weight of 546.56 g/mol. Its IUPAC name is N-[6-[3-(4-amino-3-methanimidoylanilino)indazol-1-yl]-2-pyridinyl]-2-(2,2,2-trifluoroethyl)-3,4-dihydro-2H-azepine-6-carboxamide.
| Compound Name | N-[6-[3-(4-amino-3-methanimidoylanilino)indazol-1-yl]-2-pyridinyl]-2-(2,2,2-trifluoroethyl)-3,4-dihydro-2H-azepine-6-carboxamide |
|---|---|
| PubChem CID | 167446704 |
| Molecular Formula | C28H25F3N8O |
| Molecular Weight | 546.56 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | N-[6-[3-(4-amino-3-methanimidoylanilino)indazol-1-yl]-2-pyridinyl]-2-(2,2,2-trifluoroethyl)-3,4-dihydro-2H-azepine-6-carboxamide |
| SMILES | [H]/N=C/c1cc(Nc2nn(-c3cccc(NC(=O)C4=CCCC(CC(F)(F)F)N=C4)n3)c3ccccc23)ccc1N |
| InChI | InChI=1S/C28H25F3N8O/c29-28(30,31)14-20-6-3-5-17(16-34-20)27(40)37-24-9-4-10-25(36-24)39-23-8-2-1-7-21(23)26(38-39)35-19-11-12-22(33)18(13-19)15-32/h1-2,4-5,7-13,15-16,20,32H,3,6,14,33H2,(H,35,38)(H,36,37,40)/b32-15+ |
| InChIKey | BJIOKDDPNRRSTQ-VWJSQJICSA-N |
| XLogP | 5.79 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.56 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|