C6H6F3NO — CID 167446778
(E)-2-(2,2,2-trifluoroethanimidoyl)but-2-enal (PubChem CID 167446778) has the molecular formula C6H6F3NO and a molecular weight of 165.11 g/mol. Its IUPAC name is (E)-2-(2,2,2-trifluoroethanimidoyl)but-2-enal.
| Compound Name | (E)-2-(2,2,2-trifluoroethanimidoyl)but-2-enal |
|---|---|
| PubChem CID | 167446778 |
| Molecular Formula | C6H6F3NO |
| Molecular Weight | 165.11 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | (E)-2-(2,2,2-trifluoroethanimidoyl)but-2-enal |
| SMILES | [H]/N=C(C(\C=O)=C/C)/C(F)(F)F |
| InChI | InChI=1S/C6H6F3NO/c1-2-4(3-11)5(10)6(7,8)9/h2-3,10H,1H3/b4-2-,10-5+ |
| InChIKey | LGYORQWIUMHQLN-YICFLHHFSA-N |
| XLogP | 1.71 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.11 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|