C20H19F3N8O — CID 167447138
(E)-3-amino-N-[6-[(E)-3-amino-3-(4-amino-3-methanimidoylphenyl)iminoprop-1-enyl]-2-pyridinyl]-4,4,4-trifluoro-2-methanimidoylbut-2-enamide (PubChem CID 167447138) has the molecular formula C20H19F3N8O and a molecular weight of 444.42 g/mol. Its IUPAC name is (E)-3-amino-N-[6-[(E)-3-amino-3-(4-amino-3-methanimidoylphenyl)iminoprop-1-enyl]-2-pyridinyl]-4,4,4-trifluoro-2-methanimidoylbut-2-enamide.
| Compound Name | (E)-3-amino-N-[6-[(E)-3-amino-3-(4-amino-3-methanimidoylphenyl)iminoprop-1-enyl]-2-pyridinyl]-4,4,4-trifluoro-2-methanimidoylbut-2-enamide |
|---|---|
| PubChem CID | 167447138 |
| Molecular Formula | C20H19F3N8O |
| Molecular Weight | 444.42 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | (E)-3-amino-N-[6-[(E)-3-amino-3-(4-amino-3-methanimidoylphenyl)iminoprop-1-enyl]-2-pyridinyl]-4,4,4-trifluoro-2-methanimidoylbut-2-enamide |
| SMILES | [H]/N=C/C(C(=O)Nc1cccc(/C=C/C(N)=N/c2ccc(N)c(/C=N/[H])c2)n1)=C(\N)C(F)(F)F |
| InChI | InChI=1S/C20H19F3N8O/c21-20(22,23)18(28)14(10-25)19(32)31-17-3-1-2-12(30-17)5-7-16(27)29-13-4-6-15(26)11(8-13)9-24/h1-10,24-25H,26,28H2,(H2,27,29)(H,30,31,32)/b7-5+,18-14+,24-9+,25-10+ |
| InChIKey | MPRZIRSKFXMEND-PKJRSBMPSA-N |
| XLogP | 2.73 |
| TPSA | 180.11 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|