C15H14N6O — CID 167447147
4-N-[5-(3-aminophenyl)-1,3,4-oxadiazol-2-yl]-2-methanimidoylbenzene-1,4-diamine (PubChem CID 167447147) has the molecular formula C15H14N6O and a molecular weight of 294.32 g/mol. Its IUPAC name is 4-N-[5-(3-aminophenyl)-1,3,4-oxadiazol-2-yl]-2-methanimidoylbenzene-1,4-diamine.
| Compound Name | 4-N-[5-(3-aminophenyl)-1,3,4-oxadiazol-2-yl]-2-methanimidoylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 167447147 |
| Molecular Formula | C15H14N6O |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 4-N-[5-(3-aminophenyl)-1,3,4-oxadiazol-2-yl]-2-methanimidoylbenzene-1,4-diamine |
| SMILES | [H]/N=C/c1cc(Nc2nnc(-c3cccc(N)c3)o2)ccc1N |
| InChI | InChI=1S/C15H14N6O/c16-8-10-7-12(4-5-13(10)18)19-15-21-20-14(22-15)9-2-1-3-11(17)6-9/h1-8,16H,17-18H2,(H,19,21)/b16-8+ |
| InChIKey | JHTLGFLMFCUYBX-LZYBPNLTSA-N |
| XLogP | 2.64 |
| TPSA | 126.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|