About potassium 2-(3,7-dihydro-2H-1,4-benzoxazin-7-id-4-yl)-N-propan-2-ylacetamide
potassium 2-(3,7-dihydro-2H-1,4-benzoxazin-7-id-4-yl)-N-propan-2-ylacetamide (PubChem CID 167447377) has the molecular formula C13H17KN2O2
and a molecular weight of 272.39 g/mol. Its IUPAC name is potassium 2-(3,7-dihydro-2H-1,4-benzoxazin-7-id-4-yl)-N-propan-2-ylacetamide.
Molecular Properties
| Compound Name | potassium 2-(3,7-dihydro-2H-1,4-benzoxazin-7-id-4-yl)-N-propan-2-ylacetamide |
| PubChem CID | 167447377 |
| Molecular Formula | C13H17KN2O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | potassium 2-(3,7-dihydro-2H-1,4-benzoxazin-7-id-4-yl)-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)CN1CCOc2c[c-]ccc21.[K+] |
| InChI | InChI=1S/C13H17N2O2.K/c1-10(2)14-13(16)9-15-7-8-17-12-6-4-3-5-11(12)15;/h3,5-6,10H,7-9H2,1-2H3,(H,14,16);/q-1;+1 |
| InChIKey | LAHLQMANGUFYHC-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze potassium 2-(3,7-dihydro-2H-1,4-benzoxazin-7-id-4-yl)-N-propan-2-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 2-(3,7-dihydro-2H-1,4-benzoxazin-7-id-4-yl)-N-propan-2-ylacetamide?
The IUPAC name of potassium 2-(3,7-dihydro-2H-1,4-benzoxazin-7-id-4-yl)-N-propan-2-ylacetamide (CID 167447377) is potassium 2-(3,7-dihydro-2H-1,4-benzoxazin-7-id-4-yl)-N-propan-2-ylacetamide.
What is the SMILES notation for potassium 2-(3,7-dihydro-2H-1,4-benzoxazin-7-id-4-yl)-N-propan-2-ylacetamide?
The canonical SMILES for potassium 2-(3,7-dihydro-2H-1,4-benzoxazin-7-id-4-yl)-N-propan-2-ylacetamide is CC(C)NC(=O)CN1CCOc2c[c-]ccc21.[K+].
What is the InChIKey of potassium 2-(3,7-dihydro-2H-1,4-benzoxazin-7-id-4-yl)-N-propan-2-ylacetamide?
The InChIKey is LAHLQMANGUFYHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N2O2.K/c1-10(2)14-13(16)9-15-7-8-17-12-6-4-3-5-11(12)15;/h3,5-6,10H,7-9H2,1-2H3,(H,14,16);/q-1;+1.
What are the key properties of potassium 2-(3,7-dihydro-2H-1,4-benzoxazin-7-id-4-yl)-N-propan-2-ylacetamide?
potassium 2-(3,7-dihydro-2H-1,4-benzoxazin-7-id-4-yl)-N-propan-2-ylacetamide has a molecular weight of 272.39 g/mol, XLogP of -1.79, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 2-(3,7-dihydro-2H-1,4-benzoxazin-7-id-4-yl)-N-propan-2-ylacetamide is sourced from PubChem (CID 167447377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).