C20H22F3N9O2 — CID 167447742
[N'-(4-amino-3-methanimidoylphenyl)carbamimidoyl] 6-(methylamino)pyridine-2-carboximidate;(E)-3-amino-4,4,4-trifluoro-2-methanimidoylbut-2-enal (PubChem CID 167447742) has the molecular formula C20H22F3N9O2 and a molecular weight of 477.45 g/mol. Its IUPAC name is [N'-(4-amino-3-methanimidoylphenyl)carbamimidoyl] 6-(methylamino)pyridine-2-carboximidate;(E)-3-amino-4,4,4-trifluoro-2-methanimidoylbut-2-enal.
| Compound Name | [N'-(4-amino-3-methanimidoylphenyl)carbamimidoyl] 6-(methylamino)pyridine-2-carboximidate;(E)-3-amino-4,4,4-trifluoro-2-methanimidoylbut-2-enal |
|---|---|
| PubChem CID | 167447742 |
| Molecular Formula | C20H22F3N9O2 |
| Molecular Weight | 477.45 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | [N'-(4-amino-3-methanimidoylphenyl)carbamimidoyl] 6-(methylamino)pyridine-2-carboximidate;(E)-3-amino-4,4,4-trifluoro-2-methanimidoylbut-2-enal |
| SMILES | [H]/N=C/C(C=O)=C(\N)C(F)(F)F.[H]/N=C/c1cc(/N=C(\N)O/C(=N/[H])c2cccc(NC)n2)ccc1N |
| InChI | InChI=1S/C15H17N7O.C5H5F3N2O/c1-20-13-4-2-3-12(22-13)14(18)23-15(19)21-10-5-6-11(17)9(7-10)8-16;6-5(7,8)4(10)3(1-9)2-11/h2-8,16,18H,17H2,1H3,(H2,19,21)(H,20,22);1-2,9H,10H2/b16-8+,18-14+;4-3+,9-1+ |
| InChIKey | SNFQFBWBADSRGS-CRKKEBEWSA-N |
| XLogP | 2.30 |
| TPSA | 213.19 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|