C10H12ClN — CID 16744775
7-chloro-4-methyl-1,2,3,4-tetrahydroquinoline (PubChem CID 16744775) has the molecular formula C10H12ClN and a molecular weight of 181.67 g/mol. Its IUPAC name is 7-chloro-4-methyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 7-chloro-4-methyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 16744775 |
| Molecular Formula | C10H12ClN |
| Molecular Weight | 181.67 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 7-chloro-4-methyl-1,2,3,4-tetrahydroquinoline |
| SMILES | CC1CCNc2cc(Cl)ccc21 |
| InChI | InChI=1S/C10H12ClN/c1-7-4-5-12-10-6-8(11)2-3-9(7)10/h2-3,6-7,12H,4-5H2,1H3 |
| InChIKey | DZQXMEMNGQEBJN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.67 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |