C20H35BN2O — CID 167448036
CID 167448036 (PubChem CID 167448036) has the molecular formula C20H35BN2O and a molecular weight of 330.33 g/mol.
| Compound Name | CID 167448036 |
|---|---|
| PubChem CID | 167448036 |
| Molecular Formula | C20H35BN2O |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.28 |
| IUPAC Name | — |
| SMILES | CCN(CCN(C)CC(C)C)c1ccc(C(=O)C(C)C)cc1.[B]C |
| InChI | InChI=1S/C19H32N2O.CH3B/c1-7-21(13-12-20(6)14-15(2)3)18-10-8-17(9-11-18)19(22)16(4)5;1-2/h8-11,15-16H,7,12-14H2,1-6H3;1H3 |
| InChIKey | IWJWJNZDAPGKFE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|