About 3-methyl-3-(3-methylbutoxy)-N-(2-methylpropyl)butanamide;3-methylpyrrolidine-2,5-dione
3-methyl-3-(3-methylbutoxy)-N-(2-methylpropyl)butanamide;3-methylpyrrolidine-2,5-dione (PubChem CID 167448038) has the molecular formula C19H36N2O4
and a molecular weight of 356.51 g/mol. Its IUPAC name is 3-methyl-3-(3-methylbutoxy)-N-(2-methylpropyl)butanamide;3-methylpyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | 3-methyl-3-(3-methylbutoxy)-N-(2-methylpropyl)butanamide;3-methylpyrrolidine-2,5-dione |
| PubChem CID | 167448038 |
| Molecular Formula | C19H36N2O4 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | 3-methyl-3-(3-methylbutoxy)-N-(2-methylpropyl)butanamide;3-methylpyrrolidine-2,5-dione |
| SMILES | CC(C)CCOC(C)(C)CC(=O)NCC(C)C.CC1CC(=O)NC1=O |
| InChI | InChI=1S/C14H29NO2.C5H7NO2/c1-11(2)7-8-17-14(5,6)9-13(16)15-10-12(3)4;1-3-2-4(7)6-5(3)8/h11-12H,7-10H2,1-6H3,(H,15,16);3H,2H2,1H3,(H,6,7,8) |
| InChIKey | MSKGADHWUALCLQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-3-(3-methylbutoxy)-N-(2-methylpropyl)butanamide;3-methylpyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-3-(3-methylbutoxy)-N-(2-methylpropyl)butanamide;3-methylpyrrolidine-2,5-dione?
The IUPAC name of 3-methyl-3-(3-methylbutoxy)-N-(2-methylpropyl)butanamide;3-methylpyrrolidine-2,5-dione (CID 167448038) is 3-methyl-3-(3-methylbutoxy)-N-(2-methylpropyl)butanamide;3-methylpyrrolidine-2,5-dione.
What is the SMILES notation for 3-methyl-3-(3-methylbutoxy)-N-(2-methylpropyl)butanamide;3-methylpyrrolidine-2,5-dione?
The canonical SMILES for 3-methyl-3-(3-methylbutoxy)-N-(2-methylpropyl)butanamide;3-methylpyrrolidine-2,5-dione is CC(C)CCOC(C)(C)CC(=O)NCC(C)C.CC1CC(=O)NC1=O.
What is the InChIKey of 3-methyl-3-(3-methylbutoxy)-N-(2-methylpropyl)butanamide;3-methylpyrrolidine-2,5-dione?
The InChIKey is MSKGADHWUALCLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NO2.C5H7NO2/c1-11(2)7-8-17-14(5,6)9-13(16)15-10-12(3)4;1-3-2-4(7)6-5(3)8/h11-12H,7-10H2,1-6H3,(H,15,16);3H,2H2,1H3,(H,6,7,8).
What are the key properties of 3-methyl-3-(3-methylbutoxy)-N-(2-methylpropyl)butanamide;3-methylpyrrolidine-2,5-dione?
3-methyl-3-(3-methylbutoxy)-N-(2-methylpropyl)butanamide;3-methylpyrrolidine-2,5-dione has a molecular weight of 356.51 g/mol, XLogP of 2.66, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-3-(3-methylbutoxy)-N-(2-methylpropyl)butanamide;3-methylpyrrolidine-2,5-dione is sourced from PubChem (CID 167448038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).