C18H40N4O3 — CID 167448047
hydrogen peroxide;2-methylpropan-1-ol;N-[[1-(2,2,4-trimethylpentyl)triazol-4-yl]methyl]propan-2-amine (PubChem CID 167448047) has the molecular formula C18H40N4O3 and a molecular weight of 360.54 g/mol. Its IUPAC name is hydrogen peroxide;2-methylpropan-1-ol;N-[[1-(2,2,4-trimethylpentyl)triazol-4-yl]methyl]propan-2-amine.
| Compound Name | hydrogen peroxide;2-methylpropan-1-ol;N-[[1-(2,2,4-trimethylpentyl)triazol-4-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 167448047 |
| Molecular Formula | C18H40N4O3 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.31 |
| IUPAC Name | hydrogen peroxide;2-methylpropan-1-ol;N-[[1-(2,2,4-trimethylpentyl)triazol-4-yl]methyl]propan-2-amine |
| SMILES | CC(C)CC(C)(C)Cn1cc(CNC(C)C)nn1.CC(C)CO.OO |
| InChI | InChI=1S/C14H28N4.C4H10O.H2O2/c1-11(2)7-14(5,6)10-18-9-13(16-17-18)8-15-12(3)4;1-4(2)3-5;1-2/h9,11-12,15H,7-8,10H2,1-6H3;4-5H,3H2,1-2H3;1-2H |
| InChIKey | DZFCMKZLAZHFGI-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|