C21H45NO2S — CID 167448096
ethane;2,2,4,4-tetramethyl-N-[2-methyl-4-(3-sulfanylbutan-2-yloxy)butan-2-yl]hexanamide (PubChem CID 167448096) has the molecular formula C21H45NO2S and a molecular weight of 375.66 g/mol. Its IUPAC name is ethane;2,2,4,4-tetramethyl-N-[2-methyl-4-(3-sulfanylbutan-2-yloxy)butan-2-yl]hexanamide.
| Compound Name | ethane;2,2,4,4-tetramethyl-N-[2-methyl-4-(3-sulfanylbutan-2-yloxy)butan-2-yl]hexanamide |
|---|---|
| PubChem CID | 167448096 |
| Molecular Formula | C21H45NO2S |
| Molecular Weight | 375.66 g/mol |
| Exact Mass | 375.32 |
| IUPAC Name | ethane;2,2,4,4-tetramethyl-N-[2-methyl-4-(3-sulfanylbutan-2-yloxy)butan-2-yl]hexanamide |
| SMILES | CC.CCC(C)(C)CC(C)(C)C(=O)NC(C)(C)CCOC(C)C(C)S |
| InChI | InChI=1S/C19H39NO2S.C2H6/c1-10-17(4,5)13-18(6,7)16(21)20-19(8,9)11-12-22-14(2)15(3)23;1-2/h14-15,23H,10-13H2,1-9H3,(H,20,21);1-2H3 |
| InChIKey | KSPVVZQWGOKPRJ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.66 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|