About CID 167448887
CID 167448887 (PubChem CID 167448887) has the molecular formula C41H44F4N10O2S2
and a molecular weight of 849.00 g/mol.
Molecular Properties
| Compound Name | CID 167448887 |
| PubChem CID | 167448887 |
| Molecular Formula | C41H44F4N10O2S2 |
| Molecular Weight | 849.00 g/mol |
| Exact Mass | 848.30 |
| IUPAC Name | — |
| SMILES | C=CN(CCN(C)c1ccc(-n2ccc3cc(C(=O)N4CCC(F)(F)CC4)cnc32)cn1)c1ccc(-n2ccc3cc(CCC(F)(F)CCNC=O)cnc32)cn1.SS |
| InChI | InChI=1S/C41H42F4N10O2.H2S2/c1-3-52(36-7-5-34(27-48-36)54-16-9-30-22-29(24-49-37(30)54)8-11-40(42,43)12-15-46-28-56)21-20-51(2)35-6-4-33(26-47-35)55-17-10-31-23-32(25-50-38(31)55)39(57)53-18-13-41(44,45)14-19-53;1-2/h3-7,9-10,16-17,22-28H,1,8,11-15,18-21H2,2H3,(H,46,56);1-2H |
| InChIKey | NCGRMBFADNSXFV-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 117.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 59 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 849.00 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 167448887 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167448887?
The IUPAC name of CID 167448887 (CID 167448887) is not available.
What is the SMILES notation for CID 167448887?
The canonical SMILES for CID 167448887 is C=CN(CCN(C)c1ccc(-n2ccc3cc(C(=O)N4CCC(F)(F)CC4)cnc32)cn1)c1ccc(-n2ccc3cc(CCC(F)(F)CCNC=O)cnc32)cn1.SS.
What is the InChIKey of CID 167448887?
The InChIKey is NCGRMBFADNSXFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C41H42F4N10O2.H2S2/c1-3-52(36-7-5-34(27-48-36)54-16-9-30-22-29(24-49-37(30)54)8-11-40(42,43)12-15-46-28-56)21-20-51(2)35-6-4-33(26-47-35)55-17-10-31-23-32(25-50-38(31)55)39(57)53-18-13-41(44,45)14-19-53;1-2/h3-7,9-10,16-17,22-28H,1,8,11-15,18-21H2,2H3,(H,46,56);1-2H.
What are the key properties of CID 167448887?
CID 167448887 has a molecular weight of 849.00 g/mol, XLogP of 7.58, 16 rotatable bonds, 3 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167448887 is sourced from PubChem (CID 167448887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).