About 3-[(3-chloro-[1,3]thiazolo[4,5-c]pyridazin-6-yl)amino]-5-cyclopropyl-1-methylpyridin-2-one
3-[(3-chloro-[1,3]thiazolo[4,5-c]pyridazin-6-yl)amino]-5-cyclopropyl-1-methylpyridin-2-one (PubChem CID 167449304) has the molecular formula C14H12ClN5OS
and a molecular weight of 333.80 g/mol. Its IUPAC name is 3-[(3-chloro-[1,3]thiazolo[4,5-c]pyridazin-6-yl)amino]-5-cyclopropyl-1-methylpyridin-2-one.
Molecular Properties
| Compound Name | 3-[(3-chloro-[1,3]thiazolo[4,5-c]pyridazin-6-yl)amino]-5-cyclopropyl-1-methylpyridin-2-one |
| PubChem CID | 167449304 |
| Molecular Formula | C14H12ClN5OS |
| Molecular Weight | 333.80 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 3-[(3-chloro-[1,3]thiazolo[4,5-c]pyridazin-6-yl)amino]-5-cyclopropyl-1-methylpyridin-2-one |
| SMILES | Cn1cc(C2CC2)cc(Nc2nc3nnc(Cl)cc3s2)c1=O |
| InChI | InChI=1S/C14H12ClN5OS/c1-20-6-8(7-2-3-7)4-9(13(20)21)16-14-17-12-10(22-14)5-11(15)18-19-12/h4-7H,2-3H2,1H3,(H,16,17,19) |
| InChIKey | HYNCMXSMMLDFDJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.80 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[(3-chloro-[1,3]thiazolo[4,5-c]pyridazin-6-yl)amino]-5-cyclopropyl-1-methylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-chloro-[1,3]thiazolo[4,5-c]pyridazin-6-yl)amino]-5-cyclopropyl-1-methylpyridin-2-one?
The IUPAC name of 3-[(3-chloro-[1,3]thiazolo[4,5-c]pyridazin-6-yl)amino]-5-cyclopropyl-1-methylpyridin-2-one (CID 167449304) is 3-[(3-chloro-[1,3]thiazolo[4,5-c]pyridazin-6-yl)amino]-5-cyclopropyl-1-methylpyridin-2-one.
What is the SMILES notation for 3-[(3-chloro-[1,3]thiazolo[4,5-c]pyridazin-6-yl)amino]-5-cyclopropyl-1-methylpyridin-2-one?
The canonical SMILES for 3-[(3-chloro-[1,3]thiazolo[4,5-c]pyridazin-6-yl)amino]-5-cyclopropyl-1-methylpyridin-2-one is Cn1cc(C2CC2)cc(Nc2nc3nnc(Cl)cc3s2)c1=O.
What is the InChIKey of 3-[(3-chloro-[1,3]thiazolo[4,5-c]pyridazin-6-yl)amino]-5-cyclopropyl-1-methylpyridin-2-one?
The InChIKey is HYNCMXSMMLDFDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12ClN5OS/c1-20-6-8(7-2-3-7)4-9(13(20)21)16-14-17-12-10(22-14)5-11(15)18-19-12/h4-7H,2-3H2,1H3,(H,16,17,19).
What are the key properties of 3-[(3-chloro-[1,3]thiazolo[4,5-c]pyridazin-6-yl)amino]-5-cyclopropyl-1-methylpyridin-2-one?
3-[(3-chloro-[1,3]thiazolo[4,5-c]pyridazin-6-yl)amino]-5-cyclopropyl-1-methylpyridin-2-one has a molecular weight of 333.80 g/mol, XLogP of 3.06, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-chloro-[1,3]thiazolo[4,5-c]pyridazin-6-yl)amino]-5-cyclopropyl-1-methylpyridin-2-one is sourced from PubChem (CID 167449304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).