C28H47FmN4O7- — CID 167449451
fermium;N-[2-[[1-[4-(hydroxymethyl)anilino]-1-oxopropan-2-yl]amino]-2-oxoethyl]-2,2-dimethyl-4-[2-[2-methyl-1-(oxomethylamino)propan-2-yl]oxyethoxy]butanamide;propane (PubChem CID 167449451) has the molecular formula C28H47FmN4O7- and a molecular weight of 808.70 g/mol. Its IUPAC name is fermium;N-[2-[[1-[4-(hydroxymethyl)anilino]-1-oxopropan-2-yl]amino]-2-oxoethyl]-2,2-dimethyl-4-[2-[2-methyl-1-(oxomethylamino)propan-2-yl]oxyethoxy]butanamide;propane.
| Compound Name | fermium;N-[2-[[1-[4-(hydroxymethyl)anilino]-1-oxopropan-2-yl]amino]-2-oxoethyl]-2,2-dimethyl-4-[2-[2-methyl-1-(oxomethylamino)propan-2-yl]oxyethoxy]butanamide;propane |
|---|---|
| PubChem CID | 167449451 |
| Molecular Formula | C28H47FmN4O7- |
| Molecular Weight | 808.70 g/mol |
| Exact Mass | 808.44 |
| IUPAC Name | fermium;N-[2-[[1-[4-(hydroxymethyl)anilino]-1-oxopropan-2-yl]amino]-2-oxoethyl]-2,2-dimethyl-4-[2-[2-methyl-1-(oxomethylamino)propan-2-yl]oxyethoxy]butanamide;propane |
| SMILES | CC(NC(=O)CNC(=O)C(C)(C)CCOCCOC(C)(C)CN[C-]=O)C(=O)Nc1ccc(CO)cc1.CCC.[Fm] |
| InChI | InChI=1S/C25H39N4O7.C3H8.Fm/c1-18(22(33)29-20-8-6-19(15-30)7-9-20)28-21(32)14-27-23(34)24(2,3)10-11-35-12-13-36-25(4,5)16-26-17-31;1-3-2;/h6-9,18,30H,10-16H2,1-5H3,(H,26,31)(H,27,34)(H,28,32)(H,29,33);3H2,1-2H3;/q-1;; |
| InChIKey | DLFDDCGNEYNITB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 155.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.70 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|