About ethane;2-methyl-6,6a-dihydro-5aH-cyclopropa[e][1,3]benzoxazole
ethane;2-methyl-6,6a-dihydro-5aH-cyclopropa[e][1,3]benzoxazole (PubChem CID 167449512) has the molecular formula C13H21NO
and a molecular weight of 207.32 g/mol. Its IUPAC name is ethane;2-methyl-6,6a-dihydro-5aH-cyclopropa[e][1,3]benzoxazole.
Molecular Properties
| Compound Name | ethane;2-methyl-6,6a-dihydro-5aH-cyclopropa[e][1,3]benzoxazole |
| PubChem CID | 167449512 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | ethane;2-methyl-6,6a-dihydro-5aH-cyclopropa[e][1,3]benzoxazole |
| SMILES | CC.CC.Cc1nc2c(o1)C=CC1CC21 |
| InChI | InChI=1S/C9H9NO.2C2H6/c1-5-10-9-7-4-6(7)2-3-8(9)11-5;2*1-2/h2-3,6-7H,4H2,1H3;2*1-2H3 |
| InChIKey | HIBWGHAEKGVHHC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;2-methyl-6,6a-dihydro-5aH-cyclopropa[e][1,3]benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methyl-6,6a-dihydro-5aH-cyclopropa[e][1,3]benzoxazole?
The IUPAC name of ethane;2-methyl-6,6a-dihydro-5aH-cyclopropa[e][1,3]benzoxazole (CID 167449512) is ethane;2-methyl-6,6a-dihydro-5aH-cyclopropa[e][1,3]benzoxazole.
What is the SMILES notation for ethane;2-methyl-6,6a-dihydro-5aH-cyclopropa[e][1,3]benzoxazole?
The canonical SMILES for ethane;2-methyl-6,6a-dihydro-5aH-cyclopropa[e][1,3]benzoxazole is CC.CC.Cc1nc2c(o1)C=CC1CC21.
What is the InChIKey of ethane;2-methyl-6,6a-dihydro-5aH-cyclopropa[e][1,3]benzoxazole?
The InChIKey is HIBWGHAEKGVHHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO.2C2H6/c1-5-10-9-7-4-6(7)2-3-8(9)11-5;2*1-2/h2-3,6-7H,4H2,1H3;2*1-2H3.
What are the key properties of ethane;2-methyl-6,6a-dihydro-5aH-cyclopropa[e][1,3]benzoxazole?
ethane;2-methyl-6,6a-dihydro-5aH-cyclopropa[e][1,3]benzoxazole has a molecular weight of 207.32 g/mol, XLogP of 4.17, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methyl-6,6a-dihydro-5aH-cyclopropa[e][1,3]benzoxazole is sourced from PubChem (CID 167449512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).