About 4,4-difluoro-N-methoxy-N-methylcyclohexane-1-carboxamide;methyl hypochlorite
4,4-difluoro-N-methoxy-N-methylcyclohexane-1-carboxamide;methyl hypochlorite (PubChem CID 167449792) has the molecular formula C10H18ClF2NO3
and a molecular weight of 273.71 g/mol. Its IUPAC name is 4,4-difluoro-N-methoxy-N-methylcyclohexane-1-carboxamide;methyl hypochlorite.
Molecular Properties
| Compound Name | 4,4-difluoro-N-methoxy-N-methylcyclohexane-1-carboxamide;methyl hypochlorite |
| PubChem CID | 167449792 |
| Molecular Formula | C10H18ClF2NO3 |
| Molecular Weight | 273.71 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 4,4-difluoro-N-methoxy-N-methylcyclohexane-1-carboxamide;methyl hypochlorite |
| SMILES | COCl.CON(C)C(=O)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C9H15F2NO2.CH3ClO/c1-12(14-2)8(13)7-3-5-9(10,11)6-4-7;1-3-2/h7H,3-6H2,1-2H3;1H3 |
| InChIKey | ZLFOAVYMZUMHFJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.71 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4,4-difluoro-N-methoxy-N-methylcyclohexane-1-carboxamide;methyl hypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-difluoro-N-methoxy-N-methylcyclohexane-1-carboxamide;methyl hypochlorite?
The IUPAC name of 4,4-difluoro-N-methoxy-N-methylcyclohexane-1-carboxamide;methyl hypochlorite (CID 167449792) is 4,4-difluoro-N-methoxy-N-methylcyclohexane-1-carboxamide;methyl hypochlorite.
What is the SMILES notation for 4,4-difluoro-N-methoxy-N-methylcyclohexane-1-carboxamide;methyl hypochlorite?
The canonical SMILES for 4,4-difluoro-N-methoxy-N-methylcyclohexane-1-carboxamide;methyl hypochlorite is COCl.CON(C)C(=O)C1CCC(F)(F)CC1.
What is the InChIKey of 4,4-difluoro-N-methoxy-N-methylcyclohexane-1-carboxamide;methyl hypochlorite?
The InChIKey is ZLFOAVYMZUMHFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F2NO2.CH3ClO/c1-12(14-2)8(13)7-3-5-9(10,11)6-4-7;1-3-2/h7H,3-6H2,1-2H3;1H3.
What are the key properties of 4,4-difluoro-N-methoxy-N-methylcyclohexane-1-carboxamide;methyl hypochlorite?
4,4-difluoro-N-methoxy-N-methylcyclohexane-1-carboxamide;methyl hypochlorite has a molecular weight of 273.71 g/mol, XLogP of 2.62, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-difluoro-N-methoxy-N-methylcyclohexane-1-carboxamide;methyl hypochlorite is sourced from PubChem (CID 167449792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).