C10H20FN — CID 167449901
(3R,4R)-3-fluoro-2,2,4,6,6-pentamethylpiperidine (PubChem CID 167449901) has the molecular formula C10H20FN and a molecular weight of 173.27 g/mol. Its IUPAC name is (3R,4R)-3-fluoro-2,2,4,6,6-pentamethylpiperidine.
| Compound Name | (3R,4R)-3-fluoro-2,2,4,6,6-pentamethylpiperidine |
|---|---|
| PubChem CID | 167449901 |
| Molecular Formula | C10H20FN |
| Molecular Weight | 173.27 g/mol |
| Exact Mass | 173.16 |
| IUPAC Name | (3R,4R)-3-fluoro-2,2,4,6,6-pentamethylpiperidine |
| SMILES | C[C@@H]1CC(C)(C)NC(C)(C)[C@@H]1F |
| InChI | InChI=1S/C10H20FN/c1-7-6-9(2,3)12-10(4,5)8(7)11/h7-8,12H,6H2,1-5H3/t7-,8-/m1/s1 |
| InChIKey | NZPWAQRVNWKYPS-HTQZYQBOSA-N |
| XLogP | 2.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.27 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |