C12H19NO2 — CID 16744998
methyl 1,2,3,4,6,9,10,10a-octahydropyrido[1,2-a]azepine-7-carboxylate (PubChem CID 16744998) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is methyl 1,2,3,4,6,9,10,10a-octahydropyrido[1,2-a]azepine-7-carboxylate.
| Compound Name | methyl 1,2,3,4,6,9,10,10a-octahydropyrido[1,2-a]azepine-7-carboxylate |
|---|---|
| PubChem CID | 16744998 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | methyl 1,2,3,4,6,9,10,10a-octahydropyrido[1,2-a]azepine-7-carboxylate |
| SMILES | COC(=O)C1=CCCC2CCCCN2C1 |
| InChI | InChI=1S/C12H19NO2/c1-15-12(14)10-5-4-7-11-6-2-3-8-13(11)9-10/h5,11H,2-4,6-9H2,1H3 |
| InChIKey | CKCYDHSHMVQIJI-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |