C15H25N5 — CID 167450478
(Z)-4-[[(2Z,5Z)-6-amino-6-cyclopropyl-4-iminohexa-2,5-dien-3-yl]amino]-N'-methylpent-2-enimidamide (PubChem CID 167450478) has the molecular formula C15H25N5 and a molecular weight of 275.40 g/mol. Its IUPAC name is (Z)-4-[[(2Z,5Z)-6-amino-6-cyclopropyl-4-iminohexa-2,5-dien-3-yl]amino]-N'-methylpent-2-enimidamide.
| Compound Name | (Z)-4-[[(2Z,5Z)-6-amino-6-cyclopropyl-4-iminohexa-2,5-dien-3-yl]amino]-N'-methylpent-2-enimidamide |
|---|---|
| PubChem CID | 167450478 |
| Molecular Formula | C15H25N5 |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.21 |
| IUPAC Name | (Z)-4-[[(2Z,5Z)-6-amino-6-cyclopropyl-4-iminohexa-2,5-dien-3-yl]amino]-N'-methylpent-2-enimidamide |
| SMILES | [H]/N=C(/C=C(\N)C1CC1)C(=C\C)\NC(C)/C=C\C(N)=N\C |
| InChI | InChI=1S/C15H25N5/c1-4-14(13(17)9-12(16)11-6-7-11)20-10(2)5-8-15(18)19-3/h4-5,8-11,17,20H,6-7,16H2,1-3H3,(H2,18,19)/b8-5-,12-9-,14-4-,17-13- |
| InChIKey | PLRLMGQRSPLEAG-XXAJHKINSA-N |
| XLogP | 1.68 |
| TPSA | 100.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|