C27H40N6O3Si — CID 167450482
methyl 4-[[3-[5-ethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]imidazo[1,2-b]pyridazin-6-yl]amino]bicyclo[2.2.2]octane-1-carboxylate (PubChem CID 167450482) has the molecular formula C27H40N6O3Si and a molecular weight of 524.74 g/mol. Its IUPAC name is methyl 4-[[3-[5-ethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]imidazo[1,2-b]pyridazin-6-yl]amino]bicyclo[2.2.2]octane-1-carboxylate.
| Compound Name | methyl 4-[[3-[5-ethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]imidazo[1,2-b]pyridazin-6-yl]amino]bicyclo[2.2.2]octane-1-carboxylate |
|---|---|
| PubChem CID | 167450482 |
| Molecular Formula | C27H40N6O3Si |
| Molecular Weight | 524.74 g/mol |
| Exact Mass | 524.29 |
| IUPAC Name | methyl 4-[[3-[5-ethyl-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]imidazo[1,2-b]pyridazin-6-yl]amino]bicyclo[2.2.2]octane-1-carboxylate |
| SMILES | CCc1cc(-c2cnc3ccc(NC45CCC(C(=O)OC)(CC4)CC5)nn23)nn1COCC[Si](C)(C)C |
| InChI | InChI=1S/C27H40N6O3Si/c1-6-20-17-21(30-32(20)19-36-15-16-37(3,4)5)22-18-28-24-8-7-23(31-33(22)24)29-27-12-9-26(10-13-27,11-14-27)25(34)35-2/h7-8,17-18H,6,9-16,19H2,1-5H3,(H,29,31) |
| InChIKey | CGXGCIRDIIEZOA-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 95.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.74 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|