About methyl 4-[(3-bromoimidazo[1,2-b]pyridazin-6-yl)amino]bicyclo[2.2.2]octane-1-carboxylate
methyl 4-[(3-bromoimidazo[1,2-b]pyridazin-6-yl)amino]bicyclo[2.2.2]octane-1-carboxylate (PubChem CID 167450490) has the molecular formula C16H19BrN4O2
and a molecular weight of 379.26 g/mol. Its IUPAC name is methyl 4-[(3-bromoimidazo[1,2-b]pyridazin-6-yl)amino]bicyclo[2.2.2]octane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 4-[(3-bromoimidazo[1,2-b]pyridazin-6-yl)amino]bicyclo[2.2.2]octane-1-carboxylate |
| PubChem CID | 167450490 |
| Molecular Formula | C16H19BrN4O2 |
| Molecular Weight | 379.26 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | methyl 4-[(3-bromoimidazo[1,2-b]pyridazin-6-yl)amino]bicyclo[2.2.2]octane-1-carboxylate |
| SMILES | COC(=O)C12CCC(Nc3ccc4ncc(Br)n4n3)(CC1)CC2 |
| InChI | InChI=1S/C16H19BrN4O2/c1-23-14(22)15-4-7-16(8-5-15,9-6-15)19-12-2-3-13-18-10-11(17)21(13)20-12/h2-3,10H,4-9H2,1H3,(H,19,20) |
| InChIKey | SRSWTJLSPGYPOR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.26 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 4-[(3-bromoimidazo[1,2-b]pyridazin-6-yl)amino]bicyclo[2.2.2]octane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(3-bromoimidazo[1,2-b]pyridazin-6-yl)amino]bicyclo[2.2.2]octane-1-carboxylate?
The IUPAC name of methyl 4-[(3-bromoimidazo[1,2-b]pyridazin-6-yl)amino]bicyclo[2.2.2]octane-1-carboxylate (CID 167450490) is methyl 4-[(3-bromoimidazo[1,2-b]pyridazin-6-yl)amino]bicyclo[2.2.2]octane-1-carboxylate.
What is the SMILES notation for methyl 4-[(3-bromoimidazo[1,2-b]pyridazin-6-yl)amino]bicyclo[2.2.2]octane-1-carboxylate?
The canonical SMILES for methyl 4-[(3-bromoimidazo[1,2-b]pyridazin-6-yl)amino]bicyclo[2.2.2]octane-1-carboxylate is COC(=O)C12CCC(Nc3ccc4ncc(Br)n4n3)(CC1)CC2.
What is the InChIKey of methyl 4-[(3-bromoimidazo[1,2-b]pyridazin-6-yl)amino]bicyclo[2.2.2]octane-1-carboxylate?
The InChIKey is SRSWTJLSPGYPOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19BrN4O2/c1-23-14(22)15-4-7-16(8-5-15,9-6-15)19-12-2-3-13-18-10-11(17)21(13)20-12/h2-3,10H,4-9H2,1H3,(H,19,20).
What are the key properties of methyl 4-[(3-bromoimidazo[1,2-b]pyridazin-6-yl)amino]bicyclo[2.2.2]octane-1-carboxylate?
methyl 4-[(3-bromoimidazo[1,2-b]pyridazin-6-yl)amino]bicyclo[2.2.2]octane-1-carboxylate has a molecular weight of 379.26 g/mol, XLogP of 3.17, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(3-bromoimidazo[1,2-b]pyridazin-6-yl)amino]bicyclo[2.2.2]octane-1-carboxylate is sourced from PubChem (CID 167450490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).