C23H44N2O — CID 16745071
(9Z,12Z)-N-[3-(dimethylamino)propyl]octadeca-9,12-dienamide (PubChem CID 16745071) has the molecular formula C23H44N2O and a molecular weight of 364.62 g/mol. Its IUPAC name is (9Z,12Z)-N-[3-(dimethylamino)propyl]octadeca-9,12-dienamide.
| Compound Name | (9Z,12Z)-N-[3-(dimethylamino)propyl]octadeca-9,12-dienamide |
|---|---|
| PubChem CID | 16745071 |
| Molecular Formula | C23H44N2O |
| Molecular Weight | 364.62 g/mol |
| Exact Mass | 364.35 |
| IUPAC Name | (9Z,12Z)-N-[3-(dimethylamino)propyl]octadeca-9,12-dienamide |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)NCCCN(C)C |
| InChI | InChI=1S/C23H44N2O/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-23(26)24-21-19-22-25(2)3/h8-9,11-12H,4-7,10,13-22H2,1-3H3,(H,24,26)/b9-8-,12-11- |
| InChIKey | YLXASPMPBDPQLL-MURFETPASA-N |
| XLogP | 5.87 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.62 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|