C26H30F3N5O4S — CID 167451200
(1R,2S,5S)-N-[cyano(isoquinolin-4-yl)methyl]-3-[(2S)-3,3-dimethyl-2-(trifluoromethylsulfonylamino)butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 167451200) has the molecular formula C26H30F3N5O4S and a molecular weight of 565.62 g/mol. Its IUPAC name is (1R,2S,5S)-N-[cyano(isoquinolin-4-yl)methyl]-3-[(2S)-3,3-dimethyl-2-(trifluoromethylsulfonylamino)butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1R,2S,5S)-N-[cyano(isoquinolin-4-yl)methyl]-3-[(2S)-3,3-dimethyl-2-(trifluoromethylsulfonylamino)butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 167451200 |
| Molecular Formula | C26H30F3N5O4S |
| Molecular Weight | 565.62 g/mol |
| Exact Mass | 565.20 |
| IUPAC Name | (1R,2S,5S)-N-[cyano(isoquinolin-4-yl)methyl]-3-[(2S)-3,3-dimethyl-2-(trifluoromethylsulfonylamino)butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | CC(C)(C)[C@H](NS(=O)(=O)C(F)(F)F)C(=O)N1C[C@H]2[C@@H]([C@H]1C(=O)NC(C#N)c1cncc3ccccc13)C2(C)C |
| InChI | InChI=1S/C26H30F3N5O4S/c1-24(2,3)21(33-39(37,38)26(27,28)29)23(36)34-13-17-19(25(17,4)5)20(34)22(35)32-18(10-30)16-12-31-11-14-8-6-7-9-15(14)16/h6-9,11-12,17-21,33H,13H2,1-5H3,(H,32,35)/t17-,18?,19-,20-,21+/m0/s1 |
| InChIKey | UPPRVNXWPILQHF-DMEROMKCSA-N |
| XLogP | 3.25 |
| TPSA | 132.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.62 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |