C26H39N3O5Si — CID 16745164
[(2R,3R,4R,5S)-6-azido-2,3,4,5-tetramethoxyhexoxy]-tert-butyl-diphenylsilane (PubChem CID 16745164) has the molecular formula C26H39N3O5Si and a molecular weight of 501.70 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-6-azido-2,3,4,5-tetramethoxyhexoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(2R,3R,4R,5S)-6-azido-2,3,4,5-tetramethoxyhexoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 16745164 |
| Molecular Formula | C26H39N3O5Si |
| Molecular Weight | 501.70 g/mol |
| Exact Mass | 501.27 |
| IUPAC Name | [(2R,3R,4R,5S)-6-azido-2,3,4,5-tetramethoxyhexoxy]-tert-butyl-diphenylsilane |
| SMILES | CO[C@@H]([C@H](OC)[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OC)[C@H](CN=[N+]=[N-])OC |
| InChI | InChI=1S/C26H39N3O5Si/c1-26(2,3)35(20-14-10-8-11-15-20,21-16-12-9-13-17-21)34-19-23(31-5)25(33-7)24(32-6)22(30-4)18-28-29-27/h8-17,22-25H,18-19H2,1-7H3/t22-,23+,24+,25+/m0/s1 |
| InChIKey | HAOPRJZALUFDPM-ZYQDXHPFSA-N |
| XLogP | 3.93 |
| TPSA | 94.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.70 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|