C12H12N4 — CID 167452139
2,3,4,5-tetrazatetracyclo[8.6.0.02,6.011,15]hexadeca-1(10),3,5,8,11(15)-pentaene (PubChem CID 167452139) has the molecular formula C12H12N4 and a molecular weight of 212.26 g/mol. Its IUPAC name is 2,3,4,5-tetrazatetracyclo[8.6.0.02,6.011,15]hexadeca-1(10),3,5,8,11(15)-pentaene.
| Compound Name | 2,3,4,5-tetrazatetracyclo[8.6.0.02,6.011,15]hexadeca-1(10),3,5,8,11(15)-pentaene |
|---|---|
| PubChem CID | 167452139 |
| Molecular Formula | C12H12N4 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 2,3,4,5-tetrazatetracyclo[8.6.0.02,6.011,15]hexadeca-1(10),3,5,8,11(15)-pentaene |
| SMILES | C1=CC2=C(CC3=C2CCC3)n2nnnc2C1 |
| InChI | InChI=1S/C12H12N4/c1-3-8-7-11-10(9(8)4-1)5-2-6-12-13-14-15-16(11)12/h2,5H,1,3-4,6-7H2 |
| InChIKey | VCZFPGGBCXQMJO-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |