C18H19NO7 — CID 16745263
(2R)-3-(3,4-dihydroxyphenyl)-2-[3-(3,4-dihydroxyphenyl)propanoylamino]propanoic acid (PubChem CID 16745263) has the molecular formula C18H19NO7 and a molecular weight of 361.35 g/mol. Its IUPAC name is (2R)-3-(3,4-dihydroxyphenyl)-2-[3-(3,4-dihydroxyphenyl)propanoylamino]propanoic acid.
| Compound Name | (2R)-3-(3,4-dihydroxyphenyl)-2-[3-(3,4-dihydroxyphenyl)propanoylamino]propanoic acid |
|---|---|
| PubChem CID | 16745263 |
| Molecular Formula | C18H19NO7 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | (2R)-3-(3,4-dihydroxyphenyl)-2-[3-(3,4-dihydroxyphenyl)propanoylamino]propanoic acid |
| SMILES | O=C(CCc1ccc(O)c(O)c1)N[C@H](Cc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C18H19NO7/c20-13-4-1-10(8-15(13)22)3-6-17(24)19-12(18(25)26)7-11-2-5-14(21)16(23)9-11/h1-2,4-5,8-9,12,20-23H,3,6-7H2,(H,19,24)(H,25,26)/t12-/m1/s1 |
| InChIKey | FMVRAMUNMQRPNQ-GFCCVEGCSA-N |
| XLogP | 1.25 |
| TPSA | 147.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|