C23H16ClN5O3S — CID 16745288
6'-(4-chlorophenyl)-3'-(4-nitrophenyl)spiro[1H-indole-3,5'-3,3a-dihydro-2H-pyrazolo[3,4-d][1,3]thiazole]-2-one (PubChem CID 16745288) has the molecular formula C23H16ClN5O3S and a molecular weight of 477.93 g/mol. Its IUPAC name is 6'-(4-chlorophenyl)-3'-(4-nitrophenyl)spiro[1H-indole-3,5'-3,3a-dihydro-2H-pyrazolo[3,4-d][1,3]thiazole]-2-one.
| Compound Name | 6'-(4-chlorophenyl)-3'-(4-nitrophenyl)spiro[1H-indole-3,5'-3,3a-dihydro-2H-pyrazolo[3,4-d][1,3]thiazole]-2-one |
|---|---|
| PubChem CID | 16745288 |
| Molecular Formula | C23H16ClN5O3S |
| Molecular Weight | 477.93 g/mol |
| Exact Mass | 477.07 |
| IUPAC Name | 6'-(4-chlorophenyl)-3'-(4-nitrophenyl)spiro[1H-indole-3,5'-3,3a-dihydro-2H-pyrazolo[3,4-d][1,3]thiazole]-2-one |
| SMILES | O=C1Nc2ccccc2C12SC1C(=NNC1c1ccc([N+](=O)[O-])cc1)N2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H16ClN5O3S/c24-14-7-11-15(12-8-14)28-21-20(19(26-27-21)13-5-9-16(10-6-13)29(31)32)33-23(28)17-3-1-2-4-18(17)25-22(23)30/h1-12,19-20,26H,(H,25,30) |
| InChIKey | UDSONNGLQWSMBN-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.93 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|