C16H14Cl2N4O2 — CID 16745297
8-[(E)-2-(3,4-dichlorophenyl)ethenyl]-1,3,7-trimethylpurine-2,6-dione (PubChem CID 16745297) has the molecular formula C16H14Cl2N4O2 and a molecular weight of 365.22 g/mol. Its IUPAC name is 8-[(E)-2-(3,4-dichlorophenyl)ethenyl]-1,3,7-trimethylpurine-2,6-dione.
| Compound Name | 8-[(E)-2-(3,4-dichlorophenyl)ethenyl]-1,3,7-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 16745297 |
| Molecular Formula | C16H14Cl2N4O2 |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 8-[(E)-2-(3,4-dichlorophenyl)ethenyl]-1,3,7-trimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(/C=C/c3ccc(Cl)c(Cl)c3)n2C)n(C)c1=O |
| InChI | InChI=1S/C16H14Cl2N4O2/c1-20-12(7-5-9-4-6-10(17)11(18)8-9)19-14-13(20)15(23)22(3)16(24)21(14)2/h4-8H,1-3H3/b7-5+ |
| InChIKey | FJJNXSUWXZGFBM-FNORWQNLSA-N |
| XLogP | 2.45 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |