C38H39N5O6 — CID 16745311
N-[2-[[4-[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]phenyl]carbamoyl]-4,5-dimethoxyphenyl]quinoline-3-carboxamide (PubChem CID 16745311) has the molecular formula C38H39N5O6 and a molecular weight of 661.76 g/mol. Its IUPAC name is N-[2-[[4-[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]phenyl]carbamoyl]-4,5-dimethoxyphenyl]quinoline-3-carboxamide.
| Compound Name | N-[2-[[4-[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]phenyl]carbamoyl]-4,5-dimethoxyphenyl]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 16745311 |
| Molecular Formula | C38H39N5O6 |
| Molecular Weight | 661.76 g/mol |
| Exact Mass | 661.29 |
| IUPAC Name | N-[2-[[4-[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]phenyl]carbamoyl]-4,5-dimethoxyphenyl]quinoline-3-carboxamide |
| SMILES | COc1ccc(CN2CCN(c3ccc(NC(=O)c4cc(OC)c(OC)cc4NC(=O)c4cnc5ccccc5c4)cc3)CC2)cc1OC |
| InChI | InChI=1S/C38H39N5O6/c1-46-33-14-9-25(19-34(33)47-2)24-42-15-17-43(18-16-42)29-12-10-28(11-13-29)40-38(45)30-21-35(48-3)36(49-4)22-32(30)41-37(44)27-20-26-7-5-6-8-31(26)39-23-27/h5-14,19-23H,15-18,24H2,1-4H3,(H,40,45)(H,41,44) |
| InChIKey | KFUYKTYUJHLOPQ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 114.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.76 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|