C24H36N4O2 — CID 16745335
(E)-N-[(2S)-1-[(3S,6R)-6-[(4-methoxyphenyl)methyl]-3-propan-2-yl-2,3,5,6-tetrahydroimidazo[1,2-a]imidazol-7-yl]propan-2-yl]-2-methylbut-2-enamide (PubChem CID 16745335) has the molecular formula C24H36N4O2 and a molecular weight of 412.58 g/mol. Its IUPAC name is (E)-N-[(2S)-1-[(3S,6R)-6-[(4-methoxyphenyl)methyl]-3-propan-2-yl-2,3,5,6-tetrahydroimidazo[1,2-a]imidazol-7-yl]propan-2-yl]-2-methylbut-2-enamide.
| Compound Name | (E)-N-[(2S)-1-[(3S,6R)-6-[(4-methoxyphenyl)methyl]-3-propan-2-yl-2,3,5,6-tetrahydroimidazo[1,2-a]imidazol-7-yl]propan-2-yl]-2-methylbut-2-enamide |
|---|---|
| PubChem CID | 16745335 |
| Molecular Formula | C24H36N4O2 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | (E)-N-[(2S)-1-[(3S,6R)-6-[(4-methoxyphenyl)methyl]-3-propan-2-yl-2,3,5,6-tetrahydroimidazo[1,2-a]imidazol-7-yl]propan-2-yl]-2-methylbut-2-enamide |
| SMILES | C/C=C(\C)C(=O)N[C@@H](C)CN1C2=NC[C@H](C(C)C)N2C[C@H]1Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C24H36N4O2/c1-7-17(4)23(29)26-18(5)14-27-20(12-19-8-10-21(30-6)11-9-19)15-28-22(16(2)3)13-25-24(27)28/h7-11,16,18,20,22H,12-15H2,1-6H3,(H,26,29)/b17-7+/t18-,20+,22+/m0/s1 |
| InChIKey | UGYYPRCXNKYQCW-KVZWCYMHSA-N |
| XLogP | 3.09 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|